C18H27NO3SSi — CID 15474987
(3aR,7aR)-1-(4-methylphenyl)sulfonyl-3-trimethylsilyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one (PubChem CID 15474987) has the molecular formula C18H27NO3SSi and a molecular weight of 365.57 g/mol. Its IUPAC name is (3aR,7aR)-1-(4-methylphenyl)sulfonyl-3-trimethylsilyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one.
| Compound Name | (3aR,7aR)-1-(4-methylphenyl)sulfonyl-3-trimethylsilyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 15474987 |
| Molecular Formula | C18H27NO3SSi |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (3aR,7aR)-1-(4-methylphenyl)sulfonyl-3-trimethylsilyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C([Si](C)(C)C)[C@@H]3CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C18H27NO3SSi/c1-13-9-11-14(12-10-13)23(21,22)19-16-8-6-5-7-15(16)17(18(19)20)24(2,3)4/h9-12,15-17H,5-8H2,1-4H3/t15-,16-,17?/m1/s1 |
| InChIKey | JRFCNYPOEQTMFV-YNPPLXCJSA-N |
| XLogP | 3.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|