C23H30N2O3S — CID 134955033
(1R,3R,4Z,11R,14S)-17-(4-methylphenyl)sulfonyl-10,17-diazatetracyclo[9.7.0.01,14.03,10]octadec-4-en-12-one (PubChem CID 134955033) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (1R,3R,4Z,11R,14S)-17-(4-methylphenyl)sulfonyl-10,17-diazatetracyclo[9.7.0.01,14.03,10]octadec-4-en-12-one.
| Compound Name | (1R,3R,4Z,11R,14S)-17-(4-methylphenyl)sulfonyl-10,17-diazatetracyclo[9.7.0.01,14.03,10]octadec-4-en-12-one |
|---|---|
| PubChem CID | 134955033 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (1R,3R,4Z,11R,14S)-17-(4-methylphenyl)sulfonyl-10,17-diazatetracyclo[9.7.0.01,14.03,10]octadec-4-en-12-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3CC(=O)[C@@H]4N5CCCC/C=C\[C@H]5C[C@]34C2)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-17-7-9-20(10-8-17)29(27,28)24-13-11-18-14-21(26)22-23(18,16-24)15-19-6-4-2-3-5-12-25(19)22/h4,6-10,18-19,22H,2-3,5,11-16H2,1H3/b6-4-/t18-,19-,22-,23-/m0/s1 |
| InChIKey | DIKXZLQNUUJRNJ-WGCSGXEISA-N |
| XLogP | 3.15 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|