C20H25NO3S — CID 102478668
(3aR,5aS,9aS)-7,8-dimethyl-3-(4-methylphenyl)sulfonyl-3a,4,5,5a,6,9-hexahydro-2H-indeno[1,7a-b]pyrrol-1-one (PubChem CID 102478668) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (3aR,5aS,9aS)-7,8-dimethyl-3-(4-methylphenyl)sulfonyl-3a,4,5,5a,6,9-hexahydro-2H-indeno[1,7a-b]pyrrol-1-one.
| Compound Name | (3aR,5aS,9aS)-7,8-dimethyl-3-(4-methylphenyl)sulfonyl-3a,4,5,5a,6,9-hexahydro-2H-indeno[1,7a-b]pyrrol-1-one |
|---|---|
| PubChem CID | 102478668 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (3aR,5aS,9aS)-7,8-dimethyl-3-(4-methylphenyl)sulfonyl-3a,4,5,5a,6,9-hexahydro-2H-indeno[1,7a-b]pyrrol-1-one |
| SMILES | CC1=C(C)C[C@@]23C(=O)CN(S(=O)(=O)c4ccc(C)cc4)[C@@H]2CC[C@H]3C1 |
| InChI | InChI=1S/C20H25NO3S/c1-13-4-7-17(8-5-13)25(23,24)21-12-19(22)20-11-15(3)14(2)10-16(20)6-9-18(20)21/h4-5,7-8,16,18H,6,9-12H2,1-3H3/t16-,18+,20-/m0/s1 |
| InChIKey | WXHBPWKVZYPTFG-HQRMLTQVSA-N |
| XLogP | 3.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|