C15H17NO3S — CID 73001508
1-(4-methylphenyl)sulfonyl-5,6,7,7a-tetrahydro-2H-indol-3-one (PubChem CID 73001508) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5,6,7,7a-tetrahydro-2H-indol-3-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-5,6,7,7a-tetrahydro-2H-indol-3-one |
|---|---|
| PubChem CID | 73001508 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5,6,7,7a-tetrahydro-2H-indol-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=O)C3=CCCCC32)cc1 |
| InChI | InChI=1S/C15H17NO3S/c1-11-6-8-12(9-7-11)20(18,19)16-10-15(17)13-4-2-3-5-14(13)16/h4,6-9,14H,2-3,5,10H2,1H3 |
| InChIKey | WPNLKMQPFYOWNU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |