C18H21NO3S — CID 24949997
(3S,6R,8S)-3-methyl-10-(4-methylphenyl)sulfonyl-10-azatricyclo[6.3.0.03,6]undec-1-en-4-one (PubChem CID 24949997) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is (3S,6R,8S)-3-methyl-10-(4-methylphenyl)sulfonyl-10-azatricyclo[6.3.0.03,6]undec-1-en-4-one.
| Compound Name | (3S,6R,8S)-3-methyl-10-(4-methylphenyl)sulfonyl-10-azatricyclo[6.3.0.03,6]undec-1-en-4-one |
|---|---|
| PubChem CID | 24949997 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (3S,6R,8S)-3-methyl-10-(4-methylphenyl)sulfonyl-10-azatricyclo[6.3.0.03,6]undec-1-en-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C[C@@]4(C)C(=O)C[C@H]4C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C18H21NO3S/c1-12-3-5-16(6-4-12)23(21,22)19-10-13-7-15-8-17(20)18(15,2)9-14(13)11-19/h3-6,9,13,15H,7-8,10-11H2,1-2H3/t13-,15-,18-/m1/s1 |
| InChIKey | UYAQMCUCCVVMGY-DDUZABMNSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|