C18H25NO3S — CID 45112188
1-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]but-3-en-2-one (PubChem CID 45112188) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]but-3-en-2-one.
| Compound Name | 1-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 45112188 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@@H]1CC[C@H](C(C)C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-5-16(20)12-15-8-11-18(13(2)3)19(15)23(21,22)17-9-6-14(4)7-10-17/h5-7,9-10,13,15,18H,1,8,11-12H2,2-4H3/t15-,18+/m0/s1 |
| InChIKey | NLDSWKNRDXVFHO-MAUKXSAKSA-N |
| XLogP | 3.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|