C15H19NO3S — CID 11173894
(3aR,4S,6aR)-4-methyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-6-one (PubChem CID 11173894) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (3aR,4S,6aR)-4-methyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-6-one.
| Compound Name | (3aR,4S,6aR)-4-methyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-6-one |
|---|---|
| PubChem CID | 11173894 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (3aR,4S,6aR)-4-methyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H]3[C@@H](C)CC(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C15H19NO3S/c1-10-3-5-12(6-4-10)20(18,19)16-8-7-13-11(2)9-14(17)15(13)16/h3-6,11,13,15H,7-9H2,1-2H3/t11-,13+,15+/m0/s1 |
| InChIKey | HVRJRBDELXTNSQ-NJZAAPMLSA-N |
| XLogP | 1.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |