C24H28N2O5S2 — CID 11363811
(1R,5R,8S)-4,11-bis-(4-methylphenyl)sulfonyl-4,11-diazatricyclo[6.4.0.01,5]dodecan-6-one (PubChem CID 11363811) has the molecular formula C24H28N2O5S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is (1R,5R,8S)-4,11-bis-(4-methylphenyl)sulfonyl-4,11-diazatricyclo[6.4.0.01,5]dodecan-6-one.
| Compound Name | (1R,5R,8S)-4,11-bis-(4-methylphenyl)sulfonyl-4,11-diazatricyclo[6.4.0.01,5]dodecan-6-one |
|---|---|
| PubChem CID | 11363811 |
| Molecular Formula | C24H28N2O5S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (1R,5R,8S)-4,11-bis-(4-methylphenyl)sulfonyl-4,11-diazatricyclo[6.4.0.01,5]dodecan-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3CC(=O)[C@@H]4N(S(=O)(=O)c5ccc(C)cc5)CC[C@]34C2)cc1 |
| InChI | InChI=1S/C24H28N2O5S2/c1-17-3-7-20(8-4-17)32(28,29)25-13-11-19-15-22(27)23-24(19,16-25)12-14-26(23)33(30,31)21-9-5-18(2)6-10-21/h3-10,19,23H,11-16H2,1-2H3/t19-,23-,24-/m0/s1 |
| InChIKey | HRMVPMKSOUNYQR-IGKWTDBASA-N |
| XLogP | 2.74 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |