C18H25NO3S — CID 162401512
(3R)-3-[4-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]cyclopentan-1-one (PubChem CID 162401512) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is (3R)-3-[4-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]cyclopentan-1-one.
| Compound Name | (3R)-3-[4-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 162401512 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (3R)-3-[4-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]cyclopentan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C)([C@@H]3CCC(=O)C3)CC2)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-14-3-7-17(8-4-14)23(21,22)19-11-9-18(2,10-12-19)15-5-6-16(20)13-15/h3-4,7-8,15H,5-6,9-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | MAMLESICAOOPPF-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |