C17H21F3N2O3S — CID 163309070
N-[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-N-methyl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 163309070) has the molecular formula C17H21F3N2O3S and a molecular weight of 390.43 g/mol. Its IUPAC name is N-[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-N-methyl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-N-methyl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 163309070 |
| Molecular Formula | C17H21F3N2O3S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-N-methyl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN1C[C@H]2C[C@@H](N(C)S(=O)(=O)c3ccccc3C(F)(F)F)C[C@H]2CC1=O |
| InChI | InChI=1S/C17H21F3N2O3S/c1-21-10-12-8-13(7-11(12)9-16(21)23)22(2)26(24,25)15-6-4-3-5-14(15)17(18,19)20/h3-6,11-13H,7-10H2,1-2H3/t11-,12+,13-/m0/s1 |
| InChIKey | WWEXOVHQAHXVMJ-XQQFMLRXSA-N |
| XLogP | 2.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |