C21H29NO3S — CID 74627748
N-(2-cyclopentylprop-2-enyl)-4-methyl-N-[(1-methyl-3-oxocyclobutyl)methyl]benzenesulfonamide (PubChem CID 74627748) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is N-(2-cyclopentylprop-2-enyl)-4-methyl-N-[(1-methyl-3-oxocyclobutyl)methyl]benzenesulfonamide.
| Compound Name | N-(2-cyclopentylprop-2-enyl)-4-methyl-N-[(1-methyl-3-oxocyclobutyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 74627748 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-(2-cyclopentylprop-2-enyl)-4-methyl-N-[(1-methyl-3-oxocyclobutyl)methyl]benzenesulfonamide |
| SMILES | C=C(CN(CC1(C)CC(=O)C1)S(=O)(=O)c1ccc(C)cc1)C1CCCC1 |
| InChI | InChI=1S/C21H29NO3S/c1-16-8-10-20(11-9-16)26(24,25)22(15-21(3)12-19(23)13-21)14-17(2)18-6-4-5-7-18/h8-11,18H,2,4-7,12-15H2,1,3H3 |
| InChIKey | UJHBODLGBPSIOA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|