C20H27NO3S — CID 134955834
(1R,5S)-5-methyl-1-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]cyclohex-3-ene-1-carbaldehyde (PubChem CID 134955834) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is (1R,5S)-5-methyl-1-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]cyclohex-3-ene-1-carbaldehyde.
| Compound Name | (1R,5S)-5-methyl-1-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]cyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 134955834 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (1R,5S)-5-methyl-1-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]cyclohex-3-ene-1-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2C[C@@]2(C=O)CC=C[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C20H27NO3S/c1-16-7-9-19(10-8-16)25(23,24)21-12-4-6-18(21)14-20(15-22)11-3-5-17(2)13-20/h3,5,7-10,15,17-18H,4,6,11-14H2,1-2H3/t17-,18+,20-/m1/s1 |
| InChIKey | ILMBLOAONPKLEV-WSTZPKSXSA-N |
| XLogP | 3.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|