C19H23NO3S — CID 57332572
4-methyl-N-[(2R,3R)-2-methyl-1-oxo-5-phenylpentan-3-yl]benzenesulfonamide (PubChem CID 57332572) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 4-methyl-N-[(2R,3R)-2-methyl-1-oxo-5-phenylpentan-3-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2R,3R)-2-methyl-1-oxo-5-phenylpentan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57332572 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-methyl-N-[(2R,3R)-2-methyl-1-oxo-5-phenylpentan-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CCc2ccccc2)[C@@H](C)C=O)cc1 |
| InChI | InChI=1S/C19H23NO3S/c1-15-8-11-18(12-9-15)24(22,23)20-19(16(2)14-21)13-10-17-6-4-3-5-7-17/h3-9,11-12,14,16,19-20H,10,13H2,1-2H3/t16-,19+/m0/s1 |
| InChIKey | PTVGOWZTIYJUOL-QFBILLFUSA-N |
| XLogP | 3.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|