C15H19NO3S — CID 134833159
(3aS,6R,6aR)-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-6-carbaldehyde (PubChem CID 134833159) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (3aS,6R,6aR)-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-6-carbaldehyde.
| Compound Name | (3aS,6R,6aR)-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-6-carbaldehyde |
|---|---|
| PubChem CID | 134833159 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (3aS,6R,6aR)-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-6-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H]3CC[C@@H](C=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C15H19NO3S/c1-11-2-6-14(7-3-11)20(18,19)16-9-8-12-4-5-13(10-17)15(12)16/h2-3,6-7,10,12-13,15H,4-5,8-9H2,1H3/t12-,13-,15+/m0/s1 |
| InChIKey | PWPXBGUIGSMFRO-KCQAQPDRSA-N |
| XLogP | 1.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|