C14H17NO3S — CID 74078527
7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carbaldehyde (PubChem CID 74078527) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carbaldehyde.
| Compound Name | 7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carbaldehyde |
|---|---|
| PubChem CID | 74078527 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2C3CCC2C(C=O)C3)cc1 |
| InChI | InChI=1S/C14H17NO3S/c1-10-2-5-13(6-3-10)19(17,18)15-12-4-7-14(15)11(8-12)9-16/h2-3,5-6,9,11-12,14H,4,7-8H2,1H3 |
| InChIKey | JCBFZIMXHTYNFU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|