C15H21NO3S — CID 127053526
(3R,4R)-1-(4-methylphenyl)sulfonyl-4-propan-2-ylpyrrolidine-3-carbaldehyde (PubChem CID 127053526) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is (3R,4R)-1-(4-methylphenyl)sulfonyl-4-propan-2-ylpyrrolidine-3-carbaldehyde.
| Compound Name | (3R,4R)-1-(4-methylphenyl)sulfonyl-4-propan-2-ylpyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 127053526 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (3R,4R)-1-(4-methylphenyl)sulfonyl-4-propan-2-ylpyrrolidine-3-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](C(C)C)[C@@H](C=O)C2)cc1 |
| InChI | InChI=1S/C15H21NO3S/c1-11(2)15-9-16(8-13(15)10-17)20(18,19)14-6-4-12(3)5-7-14/h4-7,10-11,13,15H,8-9H2,1-3H3/t13-,15-/m1/s1 |
| InChIKey | KVFQADIBIFPEBE-UKRRQHHQSA-N |
| XLogP | 2.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|