C21H27NO3S — CID 139250216
(1Z,3R,11S)-2-methyl-5-(4-methylphenyl)sulfonyl-5-azatricyclo[9.3.0.03,7]tetradec-1-en-9-one (PubChem CID 139250216) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is (1Z,3R,11S)-2-methyl-5-(4-methylphenyl)sulfonyl-5-azatricyclo[9.3.0.03,7]tetradec-1-en-9-one.
| Compound Name | (1Z,3R,11S)-2-methyl-5-(4-methylphenyl)sulfonyl-5-azatricyclo[9.3.0.03,7]tetradec-1-en-9-one |
|---|---|
| PubChem CID | 139250216 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (1Z,3R,11S)-2-methyl-5-(4-methylphenyl)sulfonyl-5-azatricyclo[9.3.0.03,7]tetradec-1-en-9-one |
| SMILES | C/C1=C2\CCC[C@H]2CC(=O)CC2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]12 |
| InChI | InChI=1S/C21H27NO3S/c1-14-6-8-19(9-7-14)26(24,25)22-12-17-11-18(23)10-16-4-3-5-20(16)15(2)21(17)13-22/h6-9,16-17,21H,3-5,10-13H2,1-2H3/b20-15-/t16-,17?,21-/m0/s1 |
| InChIKey | GBVIEPYHSURJNI-IAKHWIBKSA-N |
| XLogP | 3.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|