C20H25NO4S — CID 134834698
(1R,5S,9R)-2-(benzenesulfonyl)-6,7-dimethyl-9-(2-oxopropyl)-2-azabicyclo[3.3.1]non-6-ene-5-carbaldehyde (PubChem CID 134834698) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is (1R,5S,9R)-2-(benzenesulfonyl)-6,7-dimethyl-9-(2-oxopropyl)-2-azabicyclo[3.3.1]non-6-ene-5-carbaldehyde.
| Compound Name | (1R,5S,9R)-2-(benzenesulfonyl)-6,7-dimethyl-9-(2-oxopropyl)-2-azabicyclo[3.3.1]non-6-ene-5-carbaldehyde |
|---|---|
| PubChem CID | 134834698 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (1R,5S,9R)-2-(benzenesulfonyl)-6,7-dimethyl-9-(2-oxopropyl)-2-azabicyclo[3.3.1]non-6-ene-5-carbaldehyde |
| SMILES | CC(=O)C[C@H]1[C@H]2CC(C)=C(C)[C@]1(C=O)CCN2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25NO4S/c1-14-11-19-18(12-15(2)23)20(13-22,16(14)3)9-10-21(19)26(24,25)17-7-5-4-6-8-17/h4-8,13,18-19H,9-12H2,1-3H3/t18-,19+,20+/m0/s1 |
| InChIKey | FVYRHBVKLPHTLN-XUVXKRRUSA-N |
| XLogP | 2.97 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|