C20H29NO3S — CID 101362851
1-[(2R,3R,3aR,6aR)-2-methyl-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]pentan-1-one (PubChem CID 101362851) has the molecular formula C20H29NO3S and a molecular weight of 363.52 g/mol. Its IUPAC name is 1-[(2R,3R,3aR,6aR)-2-methyl-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]pentan-1-one.
| Compound Name | 1-[(2R,3R,3aR,6aR)-2-methyl-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 101362851 |
| Molecular Formula | C20H29NO3S |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-[(2R,3R,3aR,6aR)-2-methyl-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]pentan-1-one |
| SMILES | CCCCC(=O)[C@@H]1[C@H]2CCC[C@H]2N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1C |
| InChI | InChI=1S/C20H29NO3S/c1-4-5-9-19(22)20-15(3)21(18-8-6-7-17(18)20)25(23,24)16-12-10-14(2)11-13-16/h10-13,15,17-18,20H,4-9H2,1-3H3/t15-,17+,18-,20+/m1/s1 |
| InChIKey | XQWBPZCOFXTZNV-QEEHTWDDSA-N |
| XLogP | 3.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |