C20H26N2O3S — CID 101362853
(2R,3R,3aR,6aR)-1-(4-methylphenyl)sulfonyl-3-pentanoyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbonitrile (PubChem CID 101362853) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is (2R,3R,3aR,6aR)-1-(4-methylphenyl)sulfonyl-3-pentanoyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbonitrile.
| Compound Name | (2R,3R,3aR,6aR)-1-(4-methylphenyl)sulfonyl-3-pentanoyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 101362853 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (2R,3R,3aR,6aR)-1-(4-methylphenyl)sulfonyl-3-pentanoyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbonitrile |
| SMILES | CCCCC(=O)[C@@H]1[C@H]2CCC[C@H]2N(S(=O)(=O)c2ccc(C)cc2)[C@H]1C#N |
| InChI | InChI=1S/C20H26N2O3S/c1-3-4-8-19(23)20-16-6-5-7-17(16)22(18(20)13-21)26(24,25)15-11-9-14(2)10-12-15/h9-12,16-18,20H,3-8H2,1-2H3/t16-,17+,18-,20+/m0/s1 |
| InChIKey | AXHVJMAZUYLGBL-HLNWXESRSA-N |
| XLogP | 3.44 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |