About ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate
ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate (PubChem CID 166447959) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate.
Analyze ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate?
The IUPAC name of ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate (CID 166447959) is ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate.
What is the SMILES notation for ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate?
The canonical SMILES for ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate is CCOC(=O)C1C=CC2=C(C=C1)OC(C)(C)O2.
What is the InChIKey of ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate?
The InChIKey is VFGJILZBZFHTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-4-15-12(14)9-5-7-10-11(8-6-9)17-13(2,3)16-10/h5-9H,4H2,1-3H3.
What are the key properties of ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate?
ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate has a molecular weight of 236.27 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-dimethyl-6H-cyclohepta[d][1,3]dioxole-6-carboxylate is sourced from PubChem (CID 166447959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).