C16H18O4 — CID 140736790
ethyl 3,3-di(cyclopenta-1,3-dien-1-yloxy)-2-methylprop-2-enoate (PubChem CID 140736790) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 3,3-di(cyclopenta-1,3-dien-1-yloxy)-2-methylprop-2-enoate.
| Compound Name | ethyl 3,3-di(cyclopenta-1,3-dien-1-yloxy)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140736790 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | ethyl 3,3-di(cyclopenta-1,3-dien-1-yloxy)-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=C(OC1=CC=CC1)OC1=CC=CC1 |
| InChI | InChI=1S/C16H18O4/c1-3-18-15(17)12(2)16(19-13-8-4-5-9-13)20-14-10-6-7-11-14/h4-8,10H,3,9,11H2,1-2H3 |
| InChIKey | QYPCCRVNMOUYGQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|