cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate

C18H20O4 — CID 67221936

IUPACcyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OC1=CC=CC1.C=C(C)C(=O)OC1=CC=CC1
InChIInChI=1S/2C9H10O2/c2*1-7(2)9(10)11-8-5-3-4-6-8/h2*3-5H,1,6H2,2H3
InChIKeyCSCDKHFDSBDHOD-UHFFFAOYSA-N
MW300.35 g/mol
LogP3.90
Rot. Bonds4

About cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate

cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate (PubChem CID 67221936) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate.

Molecular Properties

Compound Namecyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate
PubChem CID67221936
Molecular FormulaC18H20O4
Molecular Weight300.35 g/mol
Exact Mass300.14
IUPAC Namecyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OC1=CC=CC1.C=C(C)C(=O)OC1=CC=CC1
InChIInChI=1S/2C9H10O2/c2*1-7(2)9(10)11-8-5-3-4-6-8/h2*3-5H,1,6H2,2H3
InChIKeyCSCDKHFDSBDHOD-UHFFFAOYSA-N
XLogP3.90
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.35
LogP ≤ 53.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate?
The IUPAC name of cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate (CID 67221936) is cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate.
What is the SMILES notation for cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate?
The canonical SMILES for cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate is C=C(C)C(=O)OC1=CC=CC1.C=C(C)C(=O)OC1=CC=CC1.
What is the InChIKey of cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate?
The InChIKey is CSCDKHFDSBDHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H10O2/c2*1-7(2)9(10)11-8-5-3-4-6-8/h2*3-5H,1,6H2,2H3.
What are the key properties of cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate?
cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate has a molecular weight of 300.35 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate is sourced from PubChem (CID 67221936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).