C18H20O4 — CID 67221936
cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate (PubChem CID 67221936) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate.
| Compound Name | cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67221936 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1=CC=CC1.C=C(C)C(=O)OC1=CC=CC1 |
| InChI | InChI=1S/2C9H10O2/c2*1-7(2)9(10)11-8-5-3-4-6-8/h2*3-5H,1,6H2,2H3 |
| InChIKey | CSCDKHFDSBDHOD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|