C15H17FO4 — CID 166447991
dimethyl (1R)-1-(2-fluoroethyl)-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 166447991) has the molecular formula C15H17FO4 and a molecular weight of 280.30 g/mol. Its IUPAC name is dimethyl (1R)-1-(2-fluoroethyl)-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl (1R)-1-(2-fluoroethyl)-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 166447991 |
| Molecular Formula | C15H17FO4 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | dimethyl (1R)-1-(2-fluoroethyl)-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2[C@H]1CCF |
| InChI | InChI=1S/C15H17FO4/c1-19-13(17)15(14(18)20-2)9-10-5-3-4-6-11(10)12(15)7-8-16/h3-6,12H,7-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | QWSOCZAXMCOOQN-GFCCVEGCSA-N |
| XLogP | 2.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|