C11H10NOS+ — CID 166448916
4-methylthieno[2,3-a]indolizin-5-ium-4-ol (PubChem CID 166448916) has the molecular formula C11H10NOS+ and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-methylthieno[2,3-a]indolizin-5-ium-4-ol.
| Compound Name | 4-methylthieno[2,3-a]indolizin-5-ium-4-ol |
|---|---|
| PubChem CID | 166448916 |
| Molecular Formula | C11H10NOS+ |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 4-methylthieno[2,3-a]indolizin-5-ium-4-ol |
| SMILES | CC1(O)c2ccsc2-c2cccc[n+]21 |
| InChI | InChI=1S/C11H10NOS/c1-11(13)8-5-7-14-10(8)9-4-2-3-6-12(9)11/h2-7,13H,1H3/q+1 |
| InChIKey | LSOQNYNBQVOLIX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|