C16H24O3 — CID 166449292
7,9-ditert-butyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 166449292) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 7,9-ditert-butyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
| Compound Name | 7,9-ditert-butyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| PubChem CID | 166449292 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 7,9-ditert-butyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | CC(C)(C)C1=CC2(C=C(C(C)(C)C)C1=O)OCCO2 |
| InChI | InChI=1S/C16H24O3/c1-14(2,3)11-9-16(18-7-8-19-16)10-12(13(11)17)15(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | SEAXANPOPNQVIT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |