C30H58O15P2 — CID 166449441
[(2R)-2-heptanoyloxy-3-[[(2S)-3-[2-heptanoyloxyethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropyl] octanoate (PubChem CID 166449441) has the molecular formula C30H58O15P2 and a molecular weight of 720.73 g/mol. Its IUPAC name is [(2R)-2-heptanoyloxy-3-[[(2S)-3-[2-heptanoyloxyethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropyl] octanoate.
| Compound Name | [(2R)-2-heptanoyloxy-3-[[(2S)-3-[2-heptanoyloxyethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropyl] octanoate |
|---|---|
| PubChem CID | 166449441 |
| Molecular Formula | C30H58O15P2 |
| Molecular Weight | 720.73 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | [(2R)-2-heptanoyloxy-3-[[(2S)-3-[2-heptanoyloxyethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)COP(=O)(O)OCCOC(=O)CCCCCC)OC(=O)CCCCCC |
| InChI | InChI=1S/C30H58O15P2/c1-4-7-10-13-16-18-29(33)40-24-27(45-30(34)19-15-12-9-6-3)25-44-47(37,38)43-23-26(31)22-42-46(35,36)41-21-20-39-28(32)17-14-11-8-5-2/h26-27,31H,4-25H2,1-3H3,(H,35,36)(H,37,38)/t26-,27+/m0/s1 |
| InChIKey | VYZXHEZDZOAVGY-RRPNLBNLSA-N |
| XLogP | 5.91 |
| TPSA | 210.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.73 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|