C22H23N7O2 — CID 166451292
3-[4-amino-5-(furan-2-ylmethyl)pyrimidin-2-yl]imino-1-(piperazin-1-ylmethyl)indol-2-one (PubChem CID 166451292) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-[4-amino-5-(furan-2-ylmethyl)pyrimidin-2-yl]imino-1-(piperazin-1-ylmethyl)indol-2-one.
| Compound Name | 3-[4-amino-5-(furan-2-ylmethyl)pyrimidin-2-yl]imino-1-(piperazin-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 166451292 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-[4-amino-5-(furan-2-ylmethyl)pyrimidin-2-yl]imino-1-(piperazin-1-ylmethyl)indol-2-one |
| SMILES | Nc1nc(N=C2C(=O)N(CN3CCNCC3)c3ccccc32)ncc1Cc1ccco1 |
| InChI | InChI=1S/C22H23N7O2/c23-20-15(12-16-4-3-11-31-16)13-25-22(27-20)26-19-17-5-1-2-6-18(17)29(21(19)30)14-28-9-7-24-8-10-28/h1-6,11,13,24H,7-10,12,14H2,(H2,23,25,27) |
| InChIKey | AWEZLAGPYJMJEJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|