C26H19F3N4O3 — CID 166452190
4-(4-methoxyphenyl)-6-[2-(2-methoxyphenyl)ethynyl]-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 166452190) has the molecular formula C26H19F3N4O3 and a molecular weight of 492.46 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6-[2-(2-methoxyphenyl)ethynyl]-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-methoxyphenyl)-6-[2-(2-methoxyphenyl)ethynyl]-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 166452190 |
| Molecular Formula | C26H19F3N4O3 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-6-[2-(2-methoxyphenyl)ethynyl]-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(-c2nc(C#Cc3ccccc3OC)nc(Nc3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C26H19F3N4O3/c1-34-20-12-7-18(8-13-20)24-31-23(16-9-17-5-3-4-6-22(17)35-2)32-25(33-24)30-19-10-14-21(15-11-19)36-26(27,28)29/h3-8,10-15H,1-2H3,(H,30,31,32,33) |
| InChIKey | UAKVMIUBSWSJAK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|