C17H15N3O2 — CID 166453232
6-(1-methylindazol-5-yl)oxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 166453232) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 6-(1-methylindazol-5-yl)oxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1-methylindazol-5-yl)oxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 166453232 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 6-(1-methylindazol-5-yl)oxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cn1ncc2cc(Oc3ccc4c(c3)CCC(=O)N4)ccc21 |
| InChI | InChI=1S/C17H15N3O2/c1-20-16-6-4-14(9-12(16)10-18-20)22-13-3-5-15-11(8-13)2-7-17(21)19-15/h3-6,8-10H,2,7H2,1H3,(H,19,21) |
| InChIKey | MODWBGRFNYPNQA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |