C17H17NO3 — CID 78938613
6-[4-[(1R)-1-hydroxyethyl]phenoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 78938613) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 6-[4-[(1R)-1-hydroxyethyl]phenoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-[(1R)-1-hydroxyethyl]phenoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 78938613 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 6-[4-[(1R)-1-hydroxyethyl]phenoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C[C@@H](O)c1ccc(Oc2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C17H17NO3/c1-11(19)12-2-5-14(6-3-12)21-15-7-8-16-13(10-15)4-9-17(20)18-16/h2-3,5-8,10-11,19H,4,9H2,1H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | OFKLVEBIPJDCPF-LLVKDONJSA-N |
| XLogP | 3.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |