C23H31IN6O6S — CID 166455191
N-but-1-en-2-ylformamide;methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-7-oxo-6-(1,3,4-thiadiazole-2-carbonylamino)hept-2-enoate;hydroiodide (PubChem CID 166455191) has the molecular formula C23H31IN6O6S and a molecular weight of 646.51 g/mol. Its IUPAC name is N-but-1-en-2-ylformamide;methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-7-oxo-6-(1,3,4-thiadiazole-2-carbonylamino)hept-2-enoate;hydroiodide.
| Compound Name | N-but-1-en-2-ylformamide;methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-7-oxo-6-(1,3,4-thiadiazole-2-carbonylamino)hept-2-enoate;hydroiodide |
|---|---|
| PubChem CID | 166455191 |
| Molecular Formula | C23H31IN6O6S |
| Molecular Weight | 646.51 g/mol |
| Exact Mass | 646.11 |
| IUPAC Name | N-but-1-en-2-ylformamide;methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-7-oxo-6-(1,3,4-thiadiazole-2-carbonylamino)hept-2-enoate;hydroiodide |
| SMILES | C=C(CC)NC=O.CCn1cccc(NC(=O)C(CC/C=C/C(=O)OC)NC(=O)c2nncs2)c1=O.I |
| InChI | InChI=1S/C18H21N5O5S.C5H9NO.HI/c1-3-23-10-6-8-13(18(23)27)21-15(25)12(7-4-5-9-14(24)28-2)20-16(26)17-22-19-11-29-17;1-3-5(2)6-4-7;/h5-6,8-12H,3-4,7H2,1-2H3,(H,20,26)(H,21,25);4H,2-3H2,1H3,(H,6,7);1H/b9-5+;; |
| InChIKey | NTOBBEGOVZKMOX-KJDUPKRESA-N |
| XLogP | 2.24 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|