C11H22N2 — CID 166455684
N,3,7-trimethyl-3-azabicyclo[3.3.1]nonan-2-amine (PubChem CID 166455684) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N,3,7-trimethyl-3-azabicyclo[3.3.1]nonan-2-amine.
| Compound Name | N,3,7-trimethyl-3-azabicyclo[3.3.1]nonan-2-amine |
|---|---|
| PubChem CID | 166455684 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N,3,7-trimethyl-3-azabicyclo[3.3.1]nonan-2-amine |
| SMILES | CNC1C2CC(C)CC(C2)CN1C |
| InChI | InChI=1S/C11H22N2/c1-8-4-9-6-10(5-8)11(12-2)13(3)7-9/h8-12H,4-7H2,1-3H3 |
| InChIKey | MWNYGKIMJAJEKX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |