C22H24ClN3O3 — CID 166457915
tert-butyl N-[[3-chloro-5-[(2-methoxyquinolin-3-yl)methyl]-2-pyridinyl]methyl]carbamate (PubChem CID 166457915) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is tert-butyl N-[[3-chloro-5-[(2-methoxyquinolin-3-yl)methyl]-2-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-chloro-5-[(2-methoxyquinolin-3-yl)methyl]-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 166457915 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | tert-butyl N-[[3-chloro-5-[(2-methoxyquinolin-3-yl)methyl]-2-pyridinyl]methyl]carbamate |
| SMILES | COc1nc2ccccc2cc1Cc1cnc(CNC(=O)OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-22(2,3)29-21(27)25-13-19-17(23)10-14(12-24-19)9-16-11-15-7-5-6-8-18(15)26-20(16)28-4/h5-8,10-12H,9,13H2,1-4H3,(H,25,27) |
| InChIKey | JGFIESLQMHIGJO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |