C18H25N3O4 — CID 166460082
ethane;methyl 3-[[6-[(4-methoxyphenyl)methoxy]pyridazin-3-yl]amino]propanoate (PubChem CID 166460082) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is ethane;methyl 3-[[6-[(4-methoxyphenyl)methoxy]pyridazin-3-yl]amino]propanoate.
| Compound Name | ethane;methyl 3-[[6-[(4-methoxyphenyl)methoxy]pyridazin-3-yl]amino]propanoate |
|---|---|
| PubChem CID | 166460082 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | ethane;methyl 3-[[6-[(4-methoxyphenyl)methoxy]pyridazin-3-yl]amino]propanoate |
| SMILES | CC.COC(=O)CCNc1ccc(OCc2ccc(OC)cc2)nn1 |
| InChI | InChI=1S/C16H19N3O4.C2H6/c1-21-13-5-3-12(4-6-13)11-23-15-8-7-14(18-19-15)17-10-9-16(20)22-2;1-2/h3-8H,9-11H2,1-2H3,(H,17,18);1-2H3 |
| InChIKey | DJAMPVZTJQBOBV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |