C18H17N5O3 — CID 16646021
2-(4,6-dimethylpyrimidin-2-yl)-5-(furan-2-ylmethyl)-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 16646021) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-5-(furan-2-ylmethyl)-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-5-(furan-2-ylmethyl)-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 16646021 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-5-(furan-2-ylmethyl)-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | Cc1cc(C)nc(-n2[nH]c3cc(=O)n(Cc4ccco4)c(C)c3c2=O)n1 |
| InChI | InChI=1S/C18H17N5O3/c1-10-7-11(2)20-18(19-10)23-17(25)16-12(3)22(9-13-5-4-6-26-13)15(24)8-14(16)21-23/h4-8,21H,9H2,1-3H3 |
| InChIKey | KSVURAVYKJLUIX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|