About N,6-dimethylimidazo[1,2-a]pyridin-3-amine
N,6-dimethylimidazo[1,2-a]pyridin-3-amine (PubChem CID 166460733) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is N,6-dimethylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | N,6-dimethylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 166460733 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N,6-dimethylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CNc1cnc2ccc(C)cn12 |
| InChI | InChI=1S/C9H11N3/c1-7-3-4-8-11-5-9(10-2)12(8)6-7/h3-6,10H,1-2H3 |
| InChIKey | WFKRTPWFTNUKFO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,6-dimethylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of N,6-dimethylimidazo[1,2-a]pyridin-3-amine (CID 166460733) is N,6-dimethylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for N,6-dimethylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for N,6-dimethylimidazo[1,2-a]pyridin-3-amine is CNc1cnc2ccc(C)cn12.
What is the InChIKey of N,6-dimethylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is WFKRTPWFTNUKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-7-3-4-8-11-5-9(10-2)12(8)6-7/h3-6,10H,1-2H3.
What are the key properties of N,6-dimethylimidazo[1,2-a]pyridin-3-amine?
N,6-dimethylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 161.21 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 166460733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).