C17H16F3N3O — CID 109380311
2-[(6-methylimidazo[1,2-a]pyridin-3-yl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol (PubChem CID 109380311) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[(6-methylimidazo[1,2-a]pyridin-3-yl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol.
| Compound Name | 2-[(6-methylimidazo[1,2-a]pyridin-3-yl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 109380311 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(6-methylimidazo[1,2-a]pyridin-3-yl)methylamino]-2-(3,4,5-trifluorophenyl)ethanol |
| SMILES | Cc1ccc2ncc(CNC(CO)c3cc(F)c(F)c(F)c3)n2c1 |
| InChI | InChI=1S/C17H16F3N3O/c1-10-2-3-16-22-7-12(23(16)8-10)6-21-15(9-24)11-4-13(18)17(20)14(19)5-11/h2-5,7-8,15,21,24H,6,9H2,1H3 |
| InChIKey | GUEYIMSBWNKIGQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|