C18H15N5O2S — CID 166464043
6-(4-imidazol-1-ylanilino)sulfanyl-7-methyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 166464043) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 6-(4-imidazol-1-ylanilino)sulfanyl-7-methyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-(4-imidazol-1-ylanilino)sulfanyl-7-methyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 166464043 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 6-(4-imidazol-1-ylanilino)sulfanyl-7-methyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1SNc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C18H15N5O2S/c1-11-8-14-15(21-18(25)17(24)20-14)9-16(11)26-22-12-2-4-13(5-3-12)23-7-6-19-10-23/h2-10,22H,1H3,(H,20,24)(H,21,25) |
| InChIKey | GJTPPDWMIRVASD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|