C31H26N6O3 — CID 16646694
(E)-1-[4-(5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 16646694) has the molecular formula C31H26N6O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is (E)-1-[4-(5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 16646694 |
| Molecular Formula | C31H26N6O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | (E)-1-[4-(5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)N1CCN(c2ncnc3c2c(-c2ccccc2)cn3-c2ccccc2)CC1 |
| InChI | InChI=1S/C31H26N6O3/c38-28(15-14-23-8-7-13-26(20-23)37(39)40)34-16-18-35(19-17-34)30-29-27(24-9-3-1-4-10-24)21-36(31(29)33-22-32-30)25-11-5-2-6-12-25/h1-15,20-22H,16-19H2/b15-14+ |
| InChIKey | YCCQCOFALOFGPV-CCEZHUSRSA-N |
| XLogP | 5.36 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|