C31H26ClN5O — CID 16646991
(E)-1-[4-[7-(2-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 16646991) has the molecular formula C31H26ClN5O and a molecular weight of 520.04 g/mol. Its IUPAC name is (E)-1-[4-[7-(2-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[7-(2-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 16646991 |
| Molecular Formula | C31H26ClN5O |
| Molecular Weight | 520.04 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (E)-1-[4-[7-(2-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCN(c2ncnc3c2c(-c2ccccc2)cn3-c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C31H26ClN5O/c32-26-13-7-8-14-27(26)37-21-25(24-11-5-2-6-12-24)29-30(33-22-34-31(29)37)36-19-17-35(18-20-36)28(38)16-15-23-9-3-1-4-10-23/h1-16,21-22H,17-20H2/b16-15+ |
| InChIKey | TWUYLBQPOTZOJI-FOCLMDBBSA-N |
| XLogP | 6.10 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.04 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|