C20H30N2O3 — CID 166468701
azetidine;N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methylbut-3-ynamide;ethane (PubChem CID 166468701) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is azetidine;N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methylbut-3-ynamide;ethane.
| Compound Name | azetidine;N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methylbut-3-ynamide;ethane |
|---|---|
| PubChem CID | 166468701 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | azetidine;N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methylbut-3-ynamide;ethane |
| SMILES | C#CCC(=O)N(C)C(C)Cc1ccc2c(c1)OCO2.C1CNC1.CC |
| InChI | InChI=1S/C15H17NO3.C3H7N.C2H6/c1-4-5-15(17)16(3)11(2)8-12-6-7-13-14(9-12)19-10-18-13;1-2-4-3-1;1-2/h1,6-7,9,11H,5,8,10H2,2-3H3;4H,1-3H2;1-2H3 |
| InChIKey | JAEHCXKWCQZAPE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|