C28H31N3O4 — CID 166469050
3-[3-oxo-6-[(1S,2R)-2-(3-phenylpyrrolidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166469050) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1S,2R)-2-(3-phenylpyrrolidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1S,2R)-2-(3-phenylpyrrolidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166469050 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 3-[3-oxo-6-[(1S,2R)-2-(3-phenylpyrrolidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCC[C@H]4N4CCC(c5ccccc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H31N3O4/c32-26-12-11-24(27(33)29-26)31-17-20-15-21(9-10-22(20)28(31)34)35-25-8-4-7-23(25)30-14-13-19(16-30)18-5-2-1-3-6-18/h1-3,5-6,9-10,15,19,23-25H,4,7-8,11-14,16-17H2,(H,29,32,33)/t19?,23-,24?,25+/m1/s1 |
| InChIKey | QJMSCZYLMFUEHU-HWKDKTHRSA-N |
| XLogP | 3.24 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|