C30H35ClF3NO3 — CID 166473427
tert-butyl (3S)-3-[4-chloro-3-[[(2R,3R)-2-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-3-cyclopropylpropanoate (PubChem CID 166473427) has the molecular formula C30H35ClF3NO3 and a molecular weight of 550.06 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-chloro-3-[[(2R,3R)-2-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-3-cyclopropylpropanoate.
| Compound Name | tert-butyl (3S)-3-[4-chloro-3-[[(2R,3R)-2-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 166473427 |
| Molecular Formula | C30H35ClF3NO3 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | tert-butyl (3S)-3-[4-chloro-3-[[(2R,3R)-2-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-3-cyclopropylpropanoate |
| SMILES | C[C@H]([C@@H](C(=O)Nc1cc([C@@H](CC(=O)OC(C)(C)C)C2CC2)ccc1Cl)c1ccc2c(c1)CCC2)C(F)(F)F |
| InChI | InChI=1S/C30H35ClF3NO3/c1-17(30(32,33)34)27(22-11-8-18-6-5-7-20(18)14-22)28(37)35-25-15-21(12-13-24(25)31)23(19-9-10-19)16-26(36)38-29(2,3)4/h8,11-15,17,19,23,27H,5-7,9-10,16H2,1-4H3,(H,35,37)/t17-,23+,27-/m1/s1 |
| InChIKey | WTLGTCRXCMNSNC-OVEGOBCQSA-N |
| XLogP | 7.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |