C24H21ClF5NO5 — CID 166473400
(3S)-3-[4-chloro-3-[[(2S,3R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-3-cyclopropylpropanoic acid (PubChem CID 166473400) has the molecular formula C24H21ClF5NO5 and a molecular weight of 533.88 g/mol. Its IUPAC name is (3S)-3-[4-chloro-3-[[(2S,3R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-3-cyclopropylpropanoic acid.
| Compound Name | (3S)-3-[4-chloro-3-[[(2S,3R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 166473400 |
| Molecular Formula | C24H21ClF5NO5 |
| Molecular Weight | 533.88 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | (3S)-3-[4-chloro-3-[[(2S,3R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-3-cyclopropylpropanoic acid |
| SMILES | C[C@H]([C@H](C(=O)Nc1cc([C@@H](CC(=O)O)C2CC2)ccc1Cl)c1ccc2c(c1)OC(F)(F)O2)C(F)(F)F |
| InChI | InChI=1S/C24H21ClF5NO5/c1-11(23(26,27)28)21(14-5-7-18-19(9-14)36-24(29,30)35-18)22(34)31-17-8-13(4-6-16(17)25)15(10-20(32)33)12-2-3-12/h4-9,11-12,15,21H,2-3,10H2,1H3,(H,31,34)(H,32,33)/t11-,15+,21+/m1/s1 |
| InChIKey | HXSOACHPJSQRBJ-JSKPFOEOSA-N |
| XLogP | 6.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.88 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |