C14H12BrF5N2O — CID 166474235
3-[4-(4-bromo-2,3-difluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]-2-methylpropan-1-ol (PubChem CID 166474235) has the molecular formula C14H12BrF5N2O and a molecular weight of 399.16 g/mol. Its IUPAC name is 3-[4-(4-bromo-2,3-difluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]-2-methylpropan-1-ol.
| Compound Name | 3-[4-(4-bromo-2,3-difluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 166474235 |
| Molecular Formula | C14H12BrF5N2O |
| Molecular Weight | 399.16 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 3-[4-(4-bromo-2,3-difluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]-2-methylpropan-1-ol |
| SMILES | CC(CO)Cn1cc(-c2ccc(Br)c(F)c2F)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H12BrF5N2O/c1-7(6-23)4-22-5-9(13(21-22)14(18,19)20)8-2-3-10(15)12(17)11(8)16/h2-3,5,7,23H,4,6H2,1H3 |
| InChIKey | LRALCYTZPONFKR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.16 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|