C17H16N2O5 — CID 166475760
ethyl 6-hydroxy-2-(2-methoxyanilino)-1,3-benzoxazole-5-carboxylate (PubChem CID 166475760) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is ethyl 6-hydroxy-2-(2-methoxyanilino)-1,3-benzoxazole-5-carboxylate.
| Compound Name | ethyl 6-hydroxy-2-(2-methoxyanilino)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 166475760 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | ethyl 6-hydroxy-2-(2-methoxyanilino)-1,3-benzoxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2nc(Nc3ccccc3OC)oc2cc1O |
| InChI | InChI=1S/C17H16N2O5/c1-3-23-16(21)10-8-12-15(9-13(10)20)24-17(19-12)18-11-6-4-5-7-14(11)22-2/h4-9,20H,3H2,1-2H3,(H,18,19) |
| InChIKey | WQXJMXQOQQQEPJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |