C24H24F3N5O5 — CID 166476209
8-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxy-2,3-dihydro-1H-imidazo[1,2-a]quinazolin-5-imine (PubChem CID 166476209) has the molecular formula C24H24F3N5O5 and a molecular weight of 519.48 g/mol. Its IUPAC name is 8-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxy-2,3-dihydro-1H-imidazo[1,2-a]quinazolin-5-imine.
| Compound Name | 8-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxy-2,3-dihydro-1H-imidazo[1,2-a]quinazolin-5-imine |
|---|---|
| PubChem CID | 166476209 |
| Molecular Formula | C24H24F3N5O5 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 8-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxy-2,3-dihydro-1H-imidazo[1,2-a]quinazolin-5-imine |
| SMILES | COc1cc2c(cc1O[C@H]1CCOC1)/c(=N/[C@H](C)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1)nc1n2CCN1 |
| InChI | InChI=1S/C24H24F3N5O5/c1-13(14-7-15(24(25,26)27)9-16(8-14)32(33)34)29-22-18-10-21(37-17-3-6-36-12-17)20(35-2)11-19(18)31-5-4-28-23(31)30-22/h7-11,13,17H,3-6,12H2,1-2H3,(H,28,29,30)/t13-,17+/m1/s1 |
| InChIKey | XSOHAUOWBHWRRF-DYVFJYSZSA-N |
| XLogP | 4.23 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|