C19H19F3N4O3 — CID 163257254
4-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-6,7-dimethoxy-1H-quinazolin-2-one (PubChem CID 163257254) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is 4-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-6,7-dimethoxy-1H-quinazolin-2-one.
| Compound Name | 4-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-6,7-dimethoxy-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 163257254 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-6,7-dimethoxy-1H-quinazolin-2-one |
| SMILES | COc1cc2[nH]c(=O)nc(NC(C)c3cc(N)cc(C(F)(F)F)c3)c2cc1OC |
| InChI | InChI=1S/C19H19F3N4O3/c1-9(10-4-11(19(20,21)22)6-12(23)5-10)24-17-13-7-15(28-2)16(29-3)8-14(13)25-18(27)26-17/h4-9H,23H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | MQEAFDHHMLMSKN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|