C24H23F3N4O — CID 166476265
7-(2-methylidenebutoxy)-N-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]quinazolin-5-amine (PubChem CID 166476265) has the molecular formula C24H23F3N4O and a molecular weight of 440.47 g/mol. Its IUPAC name is 7-(2-methylidenebutoxy)-N-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]quinazolin-5-amine.
| Compound Name | 7-(2-methylidenebutoxy)-N-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 166476265 |
| Molecular Formula | C24H23F3N4O |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 7-(2-methylidenebutoxy)-N-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]quinazolin-5-amine |
| SMILES | C=C(CC)COc1ccc2c(c1)c(NCc1cccc(C(F)(F)F)c1C)nc1nccn12 |
| InChI | InChI=1S/C24H23F3N4O/c1-4-15(2)14-32-18-8-9-21-19(12-18)22(30-23-28-10-11-31(21)23)29-13-17-6-5-7-20(16(17)3)24(25,26)27/h5-12H,2,4,13-14H2,1,3H3,(H,28,29,30) |
| InChIKey | IUBWWZJGBCONSE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|